![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 228d5971 | 2008-12-11 16:46 | 475K | |
![[ ]](/icons/layout.gif) | 1988Analysis TCP Processing Overhead.pdf | 2008-12-15 12:37 | 764K | |
![[ ]](/icons/unknown.gif) | 256039f4 | 2008-12-15 12:54 | 727K | |
![[ ]](/icons/layout.gif) | A-Dynamic-Assessment-of-VOIP.pdf | 2009-02-11 15:39 | 146K | |
![[ ]](/icons/layout.gif) | A Comparison of Commercial and Military Computer Security Policies.pdf | 2008-12-15 12:46 | 1.0M | |
![[ ]](/icons/layout.gif) | AFBV-A-Scalable-Packet-Classification-Algorithm2002.pdf | 2009-07-21 12:38 | 114K | |
![[ ]](/icons/layout.gif) | A Framework for Scalable Global IP-Anycast (GIA).pdf | 2009-07-22 15:55 | 215K | |
![[ ]](/icons/unknown.gif) | ANA Website page links.doc | 2009-01-30 11:38 | 23K | |
![[ ]](/icons/layout.gif) | A Scheduling Service Model.pdf | 2008-12-12 15:36 | 310K | |
![[ ]](/icons/layout.gif) | A Simple Cost Model for Broadband AccessTPRC2008.pdf | 2009-09-28 17:29 | 472K | |
![[ ]](/icons/layout.gif) | Adding Service Discrimination to the Internet.pdf | 2008-12-12 15:19 | 66K | |
![[ ]](/icons/layout.gif) | Addressing Reality- An Architectural Response to Real-World Demands on the Evolving Internet.pdf | 2009-07-22 16:12 | 308K | |
![[ ]](/icons/layout.gif) | Addressing Reality an architectural response to real world demands on the evolving internetworld.pdf | 2008-12-12 12:15 | 353K | |
![[ ]](/icons/layout.gif) | A knowlege plane for the internet.pdf | 2008-12-12 12:23 | 104K | |
![[ ]](/icons/layout.gif) | Alexander.Gamero.Garrido.Thesis.2015.pdf | 2021-08-09 17:16 | 9.0M | |
![[ ]](/icons/layout.gif) | An-Insiders-Guide-to-the-Internet.pdf | 2009-07-13 13:12 | 387K | |
![[ ]](/icons/layout.gif) | An-Internet-Protocol-Address-Clustering-Algorithm.pdf | 2009-07-14 16:04 | 182K | |
![[ ]](/icons/layout.gif) | An Analysis of TCP Processing Overhead.pdf | 2008-12-15 11:19 | 849K | |
![[ ]](/icons/layout.gif) | An Introduction to Local Area Networks.pdf | 2008-12-15 13:07 | 2.5M | |
![[ ]](/icons/layout.gif) | An Overview of the AURORA Gigabit Testbed.pdf | 2008-12-12 15:53 | 228K | |
![[ ]](/icons/layout.gif) | Anna.Charny.Thesis.1998.pdf | 2009-07-09 18:36 | 7.6M | |
![[ ]](/icons/layout.gif) | Architectural Considerations for a New Generation of Protocols.pdf | 2008-12-15 11:14 | 1.2M | |
![[DIR]](/icons/folder.gif) | Berger_pdfs/ | 2010-02-19 16:20 | - | |
![[ ]](/icons/layout.gif) | Beverly-Thesis-CSAIL-TR-2008-008.pdf | 2009-01-30 17:08 | 707K | |
![[ ]](/icons/layout.gif) | Brandon.Karpf.Thesis.2017.pdf | 2021-08-09 17:20 | 1.8M | |
![[ ]](/icons/unknown.gif) | Chintan Vaishnav-Publications.doc | 2009-02-11 16:08 | 47K | |
![[ ]](/icons/layout.gif) | Chintan Vaishnav A dynamic assessment of VoIP adoption ver2.pdf | 2009-02-11 14:52 | 146K | |
![[ ]](/icons/layout.gif) | Chintan Vaishnav Punishing by Rewards for Publication Final.pdf | 2009-02-11 14:54 | 231K | |
![[ ]](/icons/layout.gif) | Clark-Thesis-MIT-LCS-TR-117.pdf | 2009-07-13 14:38 | 7.2M | |
![[DIR]](/icons/folder.gif) | Clark_pdfs/ | 2010-02-19 16:21 | - | |
![[ ]](/icons/layout.gif) | Complexity of Internet Interconnection TPRC 2007.pdf | 2009-09-25 14:20 | 587K | |
![[ ]](/icons/layout.gif) | Congestion Control With Explicit Rate Indication.pdf | 2008-12-12 15:39 | 175K | |
![[ ]](/icons/layout.gif) | D.Krairit.thesis.2001.pdf | 2009-07-09 18:11 | 13M | |
![[ ]](/icons/layout.gif) | DDC.Cost.analysis.TPRC.pdf | 2010-01-19 16:25 | 472K | |
![[ ]](/icons/layout.gif) | Design Philosophy of the DARPA Internet Protocols.pdf | 2008-12-15 12:44 | 1.1M | |
![[ ]](/icons/layout.gif) | Designing for Scale and Differentiation.pdf | 2009-07-21 14:16 | 337K | |
![[ ]](/icons/layout.gif) | Dina.Katabi.thesis.2003.pdf | 2009-07-09 17:42 | 9.1M | |
![[ ]](/icons/layout.gif) | Does_Technology_Disruption.pdf | 2009-02-11 15:42 | 1.3M | |
![[ ]](/icons/layout.gif) | Dynamic Wavelength.pdf | 2009-02-11 16:18 | 711K | |
![[ ]](/icons/layout.gif) | Effective-Keyword-based-Selection-of-Relational-Databases.pdf | 2009-07-14 16:16 | 643K | |
![[ ]](/icons/layout.gif) | Efficient At-Most-Once Messages Based on Synchronized Clocks.pdf | 2009-07-22 15:56 | 1.3M | |
![[ ]](/icons/layout.gif) | End-to-End Arguments in System Design.pdf | 2008-12-15 12:58 | 875K | |
![[ ]](/icons/layout.gif) | End 2 end argument and application design final TPRC2007.pdf | 2009-09-25 14:22 | 455K | |
![[ ]](/icons/layout.gif) | Explicit allocation of best-effort packet delivery service.pdf | 2008-12-12 14:35 | 204K | |
![[ ]](/icons/layout.gif) | Exploiting-Transport-Level-Characteristics-of-Spam.pdf | 2009-07-14 15:54 | 194K | |
![[ ]](/icons/layout.gif) | FARA reorganizing the addressing architecture.pdf | 2008-12-12 12:20 | 186K | |
![[ ]](/icons/layout.gif) | Final-report-multics-kernal-design-project-MIT-LCS-TR-196.pdf | 2009-07-13 15:00 | 3.7M | |
![[ ]](/icons/layout.gif) | George.Lee.thesis.2007.pdf | 2009-07-09 17:44 | 1.2M | |
![[ ]](/icons/layout.gif) | Greg.Troxel.Thesis.1994.pdf | 2009-07-09 18:41 | 11M | |
![[ ]](/icons/layout.gif) | ICSDS_2008_Does_Technology_Disruption_Always_Mean_Industry_Disruption_Final_for_distribution-1.pdf | 2009-02-11 14:54 | 1.3M | |
![[ ]](/icons/layout.gif) | ICSDS_2008_Does_Technology_Disruption_Always_Mean_Industry_Disruption_Final_for_distribution.pdf | 2009-02-11 14:54 | 1.3M | |
![[ ]](/icons/layout.gif) | IJCS_with_AbdElmalak_and_Jayasumana.pdf | 2009-02-11 14:58 | 450K | |
![[ ]](/icons/layout.gif) | Implementing-Aggregation-and-Broadcast-over-distributed-hash-tables.pdf | 2009-07-21 13:03 | 382K | |
![[ ]](/icons/layout.gif) | Implementing Aggregation and Broadcast over Distributed Hash Tables.pdf | 2009-07-21 14:11 | 382K | |
![[ ]](/icons/layout.gif) | Innovation and Obstacles.pdf | 2008-12-12 14:44 | 1.0M | |
![[TXT]](/icons/text.gif) | Integrated-Services-in-the-Internet-Architecture-rfc1633.txt | 2009-07-13 13:20 | 89K | |
![[DIR]](/icons/folder.gif) | JTW_pdfs/ | 2010-02-19 16:22 | - | |
![[ ]](/icons/layout.gif) | James.Loving.Thesis.2017.pdf | 2021-08-09 17:19 | 1.1M | |
![[ ]](/icons/layout.gif) | Jesse.Sowell.Thesis.2015.pdf | 2021-08-09 17:18 | 50M | |
![[ ]](/icons/layout.gif) | Ji.Li.Thesis.2008.pdf | 2009-07-09 17:13 | 1.6M | |
![[ ]](/icons/layout.gif) | Joanna.Kulik.thesis.2004.pdf | 2009-07-09 17:57 | 8.1M | |
![[ ]](/icons/layout.gif) | Joseph.Bailey.thesis.1998.pdf | 2009-07-09 18:21 | 14M | |
![[ ]](/icons/layout.gif) | Josephine.Wolff.Thesis.2015.pdf | 2021-08-09 17:14 | 1.7M | |
![[ ]](/icons/layout.gif) | LCN95_with_AbdElmalak_and_Jayasumana.pdf | 2009-02-11 14:58 | 711K | |
![[ ]](/icons/layout.gif) | LCN96_with_AbdElmalak_and_Jayasumana.pdf | 2009-02-11 14:58 | 672K | |
![[ ]](/icons/layout.gif) | LCN97_with_AbdElmalak_and_Jayasumana.pdf | 2009-02-11 14:58 | 779K | |
![[ ]](/icons/layout.gif) | Learning User Preferences for Wireless Services Provisioning.pdf | 2009-07-22 16:10 | 175K | |
![[ ]](/icons/layout.gif) | Lehr Lear Vest TPRC08 Internet Address Running on Empty-1.pdf | 2009-02-10 15:23 | 757K | |
![[ ]](/icons/layout.gif) | Lehr Lear Vest TPRC08 Internet Address Running on Empty-2.pdf | 2009-02-10 15:27 | 757K | |
![[ ]](/icons/layout.gif) | Lehr Lear Vest TPRC08 Internet Address Running on Empty-3.pdf | 2009-02-10 15:30 | 757K | |
![[ ]](/icons/layout.gif) | Lixia.Zhang.Thesis.1989.pdf | 2009-07-09 18:43 | 12M | |
![[ ]](/icons/layout.gif) | MIT-LCS-TR-117-1.pdf | 2009-07-13 14:39 | 7.2M | |
![[ ]](/icons/layout.gif) | MIT-LCS-TR-117.pdf | 2009-07-13 14:37 | 7.2M | |
![[ ]](/icons/layout.gif) | MIT-LCS-TR-196.pdf | 2009-07-13 15:00 | 3.7M | |
![[ ]](/icons/layout.gif) | MIT_TPP_Thesis_Chintan_Vaishnav_Final.pdf | 2009-02-11 14:53 | 1.3M | |
![[ ]](/icons/layout.gif) | Making the world of communications a different place.pdf | 2008-12-12 12:06 | 200K | |
![[ ]](/icons/layout.gif) | Managing-the-Health-of-Security-Experiments.pdf | 2009-07-14 15:59 | 185K | |
![[ ]](/icons/layout.gif) | MergePDFs.pdf | 2009-02-12 17:11 | 388K | |
![[ ]](/icons/layout.gif) | Mike.Afergan.Thesis.2005.pdf | 2009-07-09 17:51 | 9.8M | |
![[ ]](/icons/layout.gif) | MobiCom Poster- The Personal Router.pdf | 2009-07-22 16:02 | 92K | |
![[ ]](/icons/layout.gif) | NETBLT1987.pdf | 2008-12-15 12:48 | 878K | |
![[ ]](/icons/layout.gif) | NIRA2007.pdf | 2008-12-15 15:39 | 740K | |
![[ ]](/icons/layout.gif) | Nathaniel.Fruchter.Thesis.2019.pdf | 2021-08-09 17:22 | 2.1M | |
![[ ]](/icons/layout.gif) | Network-Neutrality-Words of Power and 800-Pound Gorillas.pdf | 2009-07-13 15:25 | 58K | |
![[ ]](/icons/layout.gif) | Observations on the Dynamics of a Congestion Control Algorithm.pdf | 2008-12-12 16:38 | 1.5M | |
![[ ]](/icons/layout.gif) | Observations on the Dynamics of a Congestion Control Alorithm The effects of two-way traffic.pdf | 2008-12-11 16:46 | 475K | |
![[ ]](/icons/layout.gif) | Peformance-Analysis.pdf | 2009-02-11 16:13 | 450K | |
![[ ]](/icons/layout.gif) | Pricing in Computer Networks.pdf | 2008-12-12 15:33 | 273K | |
![[ ]](/icons/layout.gif) | Punishing-by-rewards.pdf | 2009-02-11 15:45 | 231K | |
![[ ]](/icons/layout.gif) | Radia.Perlman.Thesis.1988.pdf | 2009-07-09 18:34 | 10M | |
![[ ]](/icons/layout.gif) | Rainer.Gawlick.Thesis.1995.pdf | 2009-07-09 18:39 | 10M | |
![[ ]](/icons/layout.gif) | Rethinking the design of the internet2001.pdf | 2008-12-12 14:32 | 172K | |
![[ ]](/icons/layout.gif) | SVM Learning of IP Address Structure for Latency Prediction.pdf | 2009-07-14 16:19 | 226K | |
![[ ]](/icons/layout.gif) | Serdar.Ozcan.Thesis.2015.pdf | 2021-08-09 17:17 | 18M | |
![[ ]](/icons/layout.gif) | Services or Infrastructure.pdf | 2008-12-12 15:45 | 588K | |
![[ ]](/icons/layout.gif) | Simson.Garfinkel.thesis.2005.pdf | 2009-07-09 17:55 | 28M | |
![[ ]](/icons/layout.gif) | Some Observations on the Dynamics of a Congestion Control Algorithm.pdf | 2008-12-15 11:12 | 671K | |
![[TXT]](/icons/text.gif) | SourceRouting.html | 2008-12-15 13:03 | 55K | |
![[DIR]](/icons/folder.gif) | SourceRouting_files/ | 2009-07-13 15:15 | - | |
![[ ]](/icons/layout.gif) | Stephen.Kent.Thesis.1980.pdf | 2009-07-09 18:28 | 21M | |
![[ ]](/icons/layout.gif) | Steve.Bauer.Thesis.2008.pdf | 2009-07-09 17:48 | 17M | |
![[ ]](/icons/layout.gif) | Submission to the European SIGOPS Workshop, 1988.pdf | 2009-07-21 14:53 | 355K | |
![[ ]](/icons/layout.gif) | Supporting Longevity in an Information Infrastructure Architecture.pdf | 2009-07-21 14:39 | 623K | |
![[ ]](/icons/layout.gif) | Supporting Real-Time Applications in an Integrated Services Packet Network.pdf | 2008-12-16 13:22 | 1.7M | |
![[ ]](/icons/layout.gif) | Symmetric Robust.pdf | 2009-02-11 16:14 | 779K | |
![[TXT]](/icons/text.gif) | The-Classroom-Information-and-Computing-Service-Abstract.html | 2009-07-13 14:36 | 1.8K | |
![[TXT]](/icons/text.gif) | The-Classroom-Infromation-and-Computing-Service.php.html | 2009-07-13 14:59 | 3.0K | |
![[DIR]](/icons/folder.gif) | The-Classroom-Infromation-and-Computing-Service.php_files/ | 2009-07-13 15:15 | - | |
![[ ]](/icons/layout.gif) | The AURORA Gigabit Testbed.pdf | 2008-12-12 15:50 | 265K | |
![[ ]](/icons/layout.gif) | The Desktop Computer as a Network Participant.pdf | 2008-12-15 12:56 | 1.2M | |
![[ ]](/icons/layout.gif) | The Structuring of Systems Using Upcalls.pdf | 2008-12-15 12:54 | 727K | |
![[ ]](/icons/layout.gif) | The design philosophy of the DARPA internet protocols.pdf | 2008-12-12 15:42 | 1.1M | |
![[ ]](/icons/layout.gif) | The disruptive user Internet appliances and the management of complexity.pdf | 2008-12-12 14:16 | 239K | |
![[ ]](/icons/layout.gif) | The past and future history of the internet.pdf | 2008-12-12 14:47 | 279K | |
![[ ]](/icons/layout.gif) | Timothy.Shepard.Thesis.1995.pdf | 2009-07-09 18:38 | 8.0M | |
![[ ]](/icons/layout.gif) | Towards Security in an Open Systems Federation.pdf | 2009-07-21 14:47 | 1.2M | |
![[ ]](/icons/layout.gif) | Tussle2002.pdf | 2008-12-12 12:38 | 194K | |
![[ ]](/icons/layout.gif) | Tussle in Cyberspace Defining Tomorrows Internet 2005's Internet.pdf | 2008-12-12 12:08 | 405K | |
![[ ]](/icons/layout.gif) | Voice-over-Internet-Protocol.pdf | 2009-02-11 15:44 | 1.3M | |
![[ ]](/icons/layout.gif) | WDM Network.pdf | 2009-02-11 16:16 | 672K | |
![[ ]](/icons/layout.gif) | Why a Ring.pdf | 2008-12-15 13:00 | 608K | |
![[ ]](/icons/layout.gif) | Workshop Report Network Research- Exploration of Dimensions and Scope.pdf | 2009-07-21 14:13 | 377K | |
![[ ]](/icons/layout.gif) | Xiaowei.Yang.Thesis.2004.pdf | 2009-07-09 17:59 | 5.4M | |
![[ ]](/icons/layout.gif) | Zane.Markel.Thesis.2017.pdf | 2021-08-09 17:21 | 888K | |
![[ ]](/icons/a.gif) | admctl.ps | 2008-12-12 15:57 | 91K | |
![[ ]](/icons/a.gif) | admctl 2.ps | 2009-01-29 14:28 | 91K | |
![[ ]](/icons/unknown.gif) | anapubs.xls | 2008-12-08 15:38 | 21K | |
![[ ]](/icons/unknown.gif) | bf0f2a94 | 2008-12-12 14:32 | 172K | |
![[ ]](/icons/layout.gif) | classic-multics.pdf | 2009-07-13 14:40 | 103K | |
![[DIR]](/icons/folder.gif) | davie_pdfs/ | 2010-02-19 16:21 | - | |
![[TXT]](/icons/text.gif) | design_distrib.html | 2008-12-15 13:05 | 4.0K | |
![[DIR]](/icons/folder.gif) | lehr_pdfs/ | 2010-02-19 16:22 | - | |
![[TXT]](/icons/text.gif) | rfc813.txt | 2009-07-13 13:48 | 38K | |
![[TXT]](/icons/text.gif) | rfc814.txt | 2009-07-13 13:51 | 25K | |
![[TXT]](/icons/text.gif) | rfc815.txt | 2009-07-13 13:52 | 15K | |
![[TXT]](/icons/text.gif) | rfc816.txt | 2009-07-13 13:53 | 20K | |
![[TXT]](/icons/text.gif) | rfc817.txt | 2009-07-13 13:54 | 46K | |
![[TXT]](/icons/text.gif) | rfc1102.txt | 2009-07-13 13:42 | 58K | |
![[TXT]](/icons/text.gif) | rfc1636.txt | 2009-07-13 13:22 | 128K | |
![[DIR]](/icons/folder.gif) | sollins_pdfs/ | 2010-02-19 16:24 | - | |
![[ ]](/icons/layout.gif) | tdu.pdf | 2008-12-12 14:15 | 239K | |
![[ ]](/icons/layout.gif) | tussle.pdf | 2008-12-12 12:37 | 194K | |
|